| Ontology | CARD's Antibiotic Resistance Ontology |
| Accession | ARO:0000012 |
| Synonym(s) | nourseothricin racemomycin streptothricin F yazumycin |
| Definition | Streptothricins are a group of N-glycoside antibiotics that include a carbamoylated D-glucosamine to which are attached a series of L-beta-lysine residues at position 2 and a streptolidine at position 1. Streptothricins vary by the number of beta-lysine residues (from 1 (nourseothricin) to 7) and target protein synthesis in bacteria and eukaryotes. |
| SMILES | NCCC[C@H](N)CC(=O)N[C@@H]1[C@H](O)[C@@H](OC(N)=O)[C@@H](CO)O[C@H]1NC1=N[C@@H]2C(=O)NC[C@@H](O)[C@H]2N1 |
| PubChem | 475825 |
| ChEBI | 60821 |
| CAS | 3808-42-2 |
| ChEMBL | CHEMBL1801945 |
| Drug Class | nucleoside antibiotic |
| Classification | 2 ontology terms | Show |
| Parent Term(s) | 1 ontology terms | Show + nucleoside antibiotic [Drug Class] |
| Sub-Term(s) | 6 ontology terms | Show |
| Publications | Kotra LP, et al. 2000. Antimicrob Agents Chemother 44(12): 3249-3256. Aminoglycosides: perspectives on mechanisms of action and resistance and strategies to counter resistance. (PMID 11083623) Mingeot-Leclercq MP, et al. 1999. Antimicrob Agents Chemother 43(4): 727-737. Aminoglycosides: activity and resistance. (PMID 10103173) Shaw KJ, et al. 1993. Microbiol Rev 57(1): 138-163. Molecular genetics of aminoglycoside resistance genes and familial relationships of the aminoglycoside-modifying enzymes. (PMID 8385262) |
| Curator | Description | Most Recent Edit |
|---|