| Ontology | CARD's Antibiotic Resistance Ontology |
| Accession | ARO:0000047 |
| Synonym(s) | Puromycin dihydrochloride Puromycin hydrochloride Stylomycin dihydrochloride |
| Definition | Puromycin is an aminonucleoside antibiotic, derived from Streptomyces alboniger, that causes premature chain termination during ribosomal protein translation. |
| SMILES | COc1ccc(C[C@H](N)C(=O)N[C@H]2[C@@H](O)[C@H](n3cnc4c(N(C)C)ncnc43)O[C@@H]2CO)cc1 |
| PubChem | 439530 |
| ChEMBL | CHEMBL469912 |
| CHEBI | 17939 |
| CAS | 53-79-2 |
| Drug Class | nucleoside antibiotic |
| Classification | 3 ontology terms | Show |
| Parent Term(s) | 1 ontology terms | Show |
| Sub-Term(s) | 5 ontology terms | Show + 30S ribosomal subunit P-site targeted_by_antibiotic + bmr confers_resistance_to_antibiotic + mdtM confers_resistance_to_antibiotic + MdtNOP confers_resistance_to_antibiotic + lmrAB Operon confers_resistance_to_antibiotic |
| Publications | Ahmed M, et al. 1995. J Bacteriol 177(14): 3904-3910. Two highly similar multidrug transporters of Bacillus subtilis whose expression is differentially regulated. (PMID 7608059) |
| Curator | Description | Most Recent Edit |
|---|