Ontology | CARD's Antibiotic Resistance Ontology |
Accession | ARO:3000497 |
Definition | Ethambutol is an antimycobacterial drug prescribed to treat tuberculosis. It is usually given in combination with other tuberculosis drugs, such as isoniazid, rifampicin, and pyrazinamide. Ethambutol inhibits arabinosyl biosynthesis, disrupting mycobacterial cell wall formation. |
SMILES | CC[C@@H](CO)NCCN[C@@H](CC)CO |
PubChem | 14052 |
ChEMBL | CHEMBL44884 |
ChEBI | 4877 |
CAS | 74-55-5 |
Drug Class | polyamine antibiotic |
Classification | 2 ontology terms | Show |
Parent Term(s) | 1 ontology terms | Show + polyamine antibiotic [Drug Class] |
Sub-Term(s) | 24 ontology terms | Show + antibiotic sensitive aftA targeted_by_antibiotic + antibiotic sensitive embA targeted_by_antibiotic + antibiotic sensitive embC targeted_by_antibiotic + antibiotic sensitive embB targeted_by_antibiotic + Antibiotic sensitive embR targeted_by_antibiotic + ethambutol resistant aftA [AMR Gene Family] confers_resistance_to_antibiotic + ethambutol resistant iniA [AMR Gene Family] confers_resistance_to_antibiotic + Ethambutol resistant iniC [AMR Gene Family] confers_resistance_to_antibiotic + Ethambutol resistant iniB [AMR Gene Family] confers_resistance_to_antibiotic + Mycobacterium tuberculosis aftA mutations confer resistance to ethambutol confers_resistance_to_antibiotic + Mycobacterium tuberculosis ubiA mutations confer resistance to ethambutol confers_resistance_to_antibiotic + ethambutol resistant embB [AMR Gene Family] confers_resistance_to_antibiotic + ethambutol resistant embC [AMR Gene Family] confers_resistance_to_antibiotic + ethambutol resistant embA [AMR Gene Family] confers_resistance_to_antibiotic + ethambutol resistant embR [AMR Gene Family] confers_resistance_to_antibiotic + Mycobacterium tuberculosis embA mutant conferring resistance to ethambutol confers_resistance_to_antibiotic + Mycobacterium tuberculosis embB mutant conferring resistance to ethambutol confers_resistance_to_antibiotic + Mycobacterium tuberculosis embC mutant conferring resistance to ethambutol confers_resistance_to_antibiotic + Mycobacterium tuberculosis embR mutant conferring resistance to ethambutol confers_resistance_to_antibiotic + Mycobacterium tuberculosis iniA mutant conferring resistance to ethambutol confers_resistance_to_antibiotic + Mycobacterium tuberculosis iniB with mutation conferring resistance to ethambutol confers_resistance_to_antibiotic + Mycobacterium tuberculosis iniC mutant conferring resistance to ethambutol confers_resistance_to_antibiotic + Mycobacterium tuberculosis variant bovis embB with mutation conferring resistance to ethambutol confers_resistance_to_antibiotic + Mycobacterium tuberculosis Rv1258c mutations confer resistance to ethambutol and capreomycin confers_resistance_to_antibiotic |
Publications | Yendapally R and Lee RE. 2008. Bioorg Med Chem Lett 18(5): 1607-1611. Design, synthesis, and evaluation of novel ethambutol analogues. (PMID 18242089) |
Curator | Description | Most Recent Edit |
---|