| Ontology | CARD's Antibiotic Resistance Ontology |
| Accession | ARO:3004022 |
| Synonym(s) | Synercid |
| Definition | An antibiotic cocktail of the streptogramin A dalfopristin and the streptogramin B quinupristin antibiotics. Used particularly to treat MRSA and vancomycin-resistant Enterococcus. |
| SMILES | CCN(CC)CCS(=O)(=O)[C@@H]1CCN2C(=O)c3coc(n3)CC(=O)C[C@H](O)/C=C(C)/C=C/CNC(=O)/C=C/[C@@H](C)[C@@H](C(C)C)OC(=O)[C@@H]12.CC[C@H]1NC(=O)[C@@H](NC(=O)c2ncccc2O)[C@@H](C)OC(=O)[C@H](c2ccccc2)NC(=O)[C@@H]2CC(=O)[C@H](CS[C@@H]3CN4CCC3CC4)CN2C(=O)[C@H](Cc2ccc(N(C)C)cc2)N(C)C(=O)[C@@H]2CCCN2C1=O |
| PubChem | 25199981 |
| ChEMBL | CHEMBL3137691 |
| ChEBI | 8733 |
| Drug Class | streptogramin antibiotic, streptogramin B antibiotic, streptogramin A antibiotic |
| Classification | 5 ontology terms | Show + process or component of antibiotic biology or chemistry + antibiotic molecule + streptogramin antibiotic [Drug Class] + streptogramin B antibiotic [Drug Class] + streptogramin A antibiotic [Drug Class] |
| Parent Term(s) | 3 ontology terms | Show |
| Sub-Term(s) | 1 ontology terms | Show + clcD confers_resistance_to_antibiotic |
| Curator | Description | Most Recent Edit |
|---|