| Ontology | CARD's Antibiotic Resistance Ontology |
| Accession | ARO:3000324 |
| Definition | Sulfadiazine is a potent inhibitor of dihydropteroate synthase, interfering with the tetrahydrofolic biosynthesis pathway. Tetrahydrofolic acid is essential for folate synthesis, a precursor to many nucleotides and amino acids. |
| SMILES | Nc1ccc(S(=O)(=O)Nc2ncccn2)cc1 |
| PubChem | 5215 |
| ChEMBL | CHEMBL439 |
| ChEBI | 9328 |
| CAS | 68-35-9 |
| Drug Class | sulfonamide antibiotic |
| Classification | 2 ontology terms | Show |
| Parent Term(s) | 1 ontology terms | Show + sulfonamide antibiotic [Drug Class] |
| Sub-Term(s) | 6 ontology terms | Show + antibiotic sensitive dihydropteroate synthase targeted_by_antibiotic + sul1 confers_resistance_to_antibiotic + sul2 confers_resistance_to_antibiotic + sul3 confers_resistance_to_antibiotic + Escherichia coli folP with mutation conferring resistance to sulfonamides confers_resistance_to_antibiotic + Streptococcus pyogenes folP with mutation conferring resistance to sulfonamides confers_resistance_to_antibiotic |
| Publications | McCullough JL and Maren TH. 1973. Antimicrob Agents Chemother 3(6): 665-669. Inhibition of dihydropteroate synthetase from Escherichia coli by sulfones and sulfonamides. (PMID 4597736) |
| Curator | Description | Most Recent Edit |
|---|