| Ontology | CARD's Antibiotic Resistance Ontology |
| Accession | ARO:3000325 |
| Synonym(s) | sulfamethazine |
| Definition | Sulfadimidine is an alkaline sulfonamide antibiotic that inhibits dihydropteroate synthase, and enzyme in the tetrahydrofolic acid biosynthesis pathway. This interferes with the production of folate, which is a precursor to many amino acids and nucleotides. |
| SMILES | Cc1cc(C)nc(NS(=O)(=O)c2ccc(N)cc2)n1 |
| PubChem | 5327 |
| ChEMBL | CHEMBL446 |
| ChEBI | 102265 |
| CAS | 57-68-1 |
| Drug Class | sulfonamide antibiotic |
| Classification | 2 ontology terms | Show |
| Parent Term(s) | 1 ontology terms | Show + sulfonamide antibiotic [Drug Class] |
| Sub-Term(s) | 6 ontology terms | Show + antibiotic sensitive dihydropteroate synthase targeted_by_antibiotic + sul1 confers_resistance_to_antibiotic + sul2 confers_resistance_to_antibiotic + sul3 confers_resistance_to_antibiotic + Escherichia coli folP with mutation conferring resistance to sulfonamides confers_resistance_to_antibiotic + Streptococcus pyogenes folP with mutation conferring resistance to sulfonamides confers_resistance_to_antibiotic |
| Publications | Antunes P, et al. 2005. Antimicrob Agents Chemother 49(2): 836-839. Dissemination of sulfonamide resistance genes (sul1, sul2, and sul3) in Portuguese Salmonella enterica strains and relation with integrons. (PMID 15673783) |
| Curator | Description | Most Recent Edit |
|---|