| Ontology | CARD's Antibiotic Resistance Ontology |
| Accession | ARO:3000628 |
| Definition | Polymyxin B4 is in the family of polymyxin lipopeptides with a heptanoic acid acyl group. These antibiotics disrupt the cell membrane of Gram-negative bacteria. |
| SMILES | CCCCCCC(=O)N[C@@H](CCN)C(=O)N[C@H](C(=O)N[C@@H](CCN)C(=O)N[C@H]1CCNC(=O)[C@H]([C@@H](C)O)NC(=O)[C@H](CCN)NC(=O)[C@H](CCN)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](Cc2ccccc2)NC(=O)[C@H](CCN)NC1=O)[C@@H](C)O |
| PubChem | 46883543 |
| ChEMBL | CHEMBL1088940 |
| Drug Class | peptide antibiotic |
| Classification | 6 ontology terms | Show |
| Parent Term(s) | 2 ontology terms | Show |
| Sub-Term(s) | 4 ontology terms | Show + cell membrane component targeted by antibiotic targeted_by_antibiotic + Klebsiella pneumoniae KpnGH-TolC confers_resistance_to_antibiotic + RosAB confers_resistance_to_antibiotic + lipid A phosphatase [AMR Gene Family] confers_resistance_to_antibiotic |
| Publications | Orwa JA, et al. 2001. J Chromatogr A 912(2): 369-373. Isolation and structural characterization of polymyxin B components. (PMID 11330807) |
| Curator | Description | Most Recent Edit |
|---|
