Ontology | CARD's Antibiotic Resistance Ontology |
Accession | ARO:3000454 |
Definition | Polymyxin B is mixture of mostly polymyxins B1 and B2, mainly used for resistant gram-negative infections. They are polypeptides with cationic detergent action on cell membranes. |
SMILES | CC(C)CCCCC(=O)N[C@@H](CCN)C(=O)N[C@H](C(=O)N[C@@H](CCN)C(=O)N[C@H]1CCNC(=O)[C@H]([C@@H](C)O)NC(=O)[C@H](CCN)NC(=O)[C@H](CCN)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](Cc2ccccc2)NC(=O)[C@@H](CCN)NC1=O)[C@@H](C)O.CC[C@H](C)CCCCC(=O)N[C@@H](CCN)C(=O)N[C@H](C(=O)N[C@@H](CCN)C(=O)N[C@H]1CCNC(=O)[C@H]([C@@H](C)O)NC(=O)[C@H](CCN)NC(=O)[C@H](CCN)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](Cc2ccccc2)NC(=O)[C@@H](CCN)NC1=O)[C@@H](C)O |
PubChem | 49800004 |
ChEMBL | CHEMBL5314354 |
ChEMBL | CHEMBL3989738 |
ChEBI | 59063 |
CAS | 1404-26-8 |
ChEBI | 8309 |
Drug Class | peptide antibiotic |
Classification | 4 ontology terms | Show |
Parent Term(s) | 2 ontology terms | Show |
Sub-Term(s) | 13 ontology terms | Show + polymyxin B1 [Antibiotic] + polymyxin B2 [Antibiotic] + polymyxin B3 [Antibiotic] + polymyxin B4 [Antibiotic] + LpsA confers_resistance_to_antibiotic + OmpA confers_resistance_to_antibiotic + PmrF confers_resistance_to_antibiotic + arnA confers_resistance_to_antibiotic + eptA confers_resistance_to_antibiotic + eptB confers_resistance_to_antibiotic + ugd confers_resistance_to_antibiotic + pgpB confers_resistance_to_antibiotic + LptD confers_resistance_to_antibiotic |
Publications | Cardoso LS, et al. 2007. Microb Cell Fact 6: 1. Polymyxin B as inhibitor of LPS contamination of Schistosoma mansoni recombinant proteins in human cytokine analysis. (PMID 17201926) |
Curator | Description | Most Recent Edit |
---|