| Ontology | CARD's Antibiotic Resistance Ontology |
| Accession | ARO:3000454 |
| Definition | Polymyxin B is mixture of mostly polymyxins B1 and B2, mainly used for resistant gram-negative infections. They are polypeptides with cationic detergent action on cell membranes. |
| SMILES | CC(C)CCCCC(=O)N[C@@H](CCN)C(=O)N[C@H](C(=O)N[C@@H](CCN)C(=O)N[C@H]1CCNC(=O)[C@H]([C@@H](C)O)NC(=O)[C@H](CCN)NC(=O)[C@H](CCN)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](Cc2ccccc2)NC(=O)[C@@H](CCN)NC1=O)[C@@H](C)O.CC[C@H](C)CCCCC(=O)N[C@@H](CCN)C(=O)N[C@H](C(=O)N[C@@H](CCN)C(=O)N[C@H]1CCNC(=O)[C@H]([C@@H](C)O)NC(=O)[C@H](CCN)NC(=O)[C@H](CCN)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](Cc2ccccc2)NC(=O)[C@@H](CCN)NC1=O)[C@@H](C)O |
| PubChem | 49800004 |
| ChEMBL | CHEMBL5314354 |
| ChEMBL | CHEMBL3989738 |
| CHEBI | 59063 |
| CAS | 1404-26-8 |
| CHEBI | 8309 |
| Drug Class | peptide antibiotic, nonribosomal peptide antibiotics |
| Classification | 5 ontology terms | Show + process or component of antibiotic biology or chemistry + antibiotic molecule + peptide antibiotic [Drug Class] + nonribosomal peptide antibiotics [Drug Class] + lipopeptide antibiotic |
| Parent Term(s) | 2 ontology terms | Show |
| Sub-Term(s) | 13 ontology terms | Show + polymyxin B1 [Antibiotic] + polymyxin B2 [Antibiotic] + polymyxin B3 [Antibiotic] + polymyxin B4 [Antibiotic] + LpsA confers_resistance_to_antibiotic + OmpA confers_resistance_to_antibiotic + PmrF confers_resistance_to_antibiotic + arnA confers_resistance_to_antibiotic + eptA confers_resistance_to_antibiotic + eptB confers_resistance_to_antibiotic + ugd confers_resistance_to_antibiotic + pgpB confers_resistance_to_antibiotic + LptD confers_resistance_to_antibiotic |
| Publications | Cardoso LS, et al. 2007. Microb Cell Fact 6: 1. Polymyxin B as inhibitor of LPS contamination of Schistosoma mansoni recombinant proteins in human cytokine analysis. (PMID 17201926) |
| Curator | Description | Most Recent Edit |
|---|