| Ontology | CARD's Antibiotic Resistance Ontology |
| Accession | ARO:3000629 |
| Definition | Bacitracin A is the primary component of bacitracin. It contains many uncommon amino acids and interferes with bacterial cell wall synthesis. |
| SMILES | CC[C@H](C)[C@@H](N)C1=N[C@@H](C(=O)N[C@H](CC(C)C)C(=O)N[C@@H](CCC(=O)O)C(=O)N[C@@H](C(=O)N[C@@H]2CCCCNC(=O)[C@@H](CC(N)=O)NC(=O)[C@H](CC(=O)O)NC(=O)[C@@H](Cc3c[nH]cn3)NC(=O)[C@H](Cc3ccccc3)NC(=O)[C@@H]([C@@H](C)CC)NC(=O)[C@H](CCCN)NC2=O)[C@@H](C)CC)CS1 |
| PubChem | 10909430 |
| ChEBI | 35862 |
| ChEMBL | CHEMBL1790520 |
| Drug Class | peptide antibiotic |
| Classification | 4 ontology terms | Show |
| Parent Term(s) | 1 ontology terms | Show + bacitracin [Antibiotic] |
| Sub-Term(s) | 6 ontology terms | Show + bacitracin sensitive isoprenyl pyrophosphate targeted_by_antibiotic + undecaprenyl pyrophosphate targeted_by_antibiotic + bcrC confers_resistance_to_antibiotic + bacA confers_resistance_to_antibiotic + bcrA confers_resistance_to_antibiotic + bcrB confers_resistance_to_antibiotic |
| Publications | Toscano WA Jr and Storm DR. 1982. Pharmacol Ther 16(2): 199-210. Bacitracin. (PMID 6752975) |
| Curator | Description | Most Recent Edit |
|---|
