| Ontology | CARD's Antibiotic Resistance Ontology |
| Accession | ARO:3000698 |
| Synonym(s) | salicylazosulfapyridine |
| Definition | Sulfasalazine is a derivative of the early sulfonamide sulfapyridine (salicylazosulfapyridine). It was developed to increase water solubility and is taken orally for ulcerative colitis. |
| SMILES | O=C(O)c1cc(/N=N/c2ccc(S(=O)(=O)Nc3ccccn3)cc2)ccc1O |
| PubChem | 5339 |
| ChEBI | 9334 |
| CAS | 599-79-1 |
| ChEMBL | CHEMBL421 |
| Drug Class | sulfonamide antibiotic |
| Classification | 2 ontology terms | Show |
| Parent Term(s) | 1 ontology terms | Show + sulfonamide antibiotic [Drug Class] |
| Sub-Term(s) | 6 ontology terms | Show + antibiotic sensitive dihydropteroate synthase targeted_by_antibiotic + sul1 confers_resistance_to_antibiotic + sul2 confers_resistance_to_antibiotic + sul3 confers_resistance_to_antibiotic + Escherichia coli folP with mutation conferring resistance to sulfonamides confers_resistance_to_antibiotic + Streptococcus pyogenes folP with mutation conferring resistance to sulfonamides confers_resistance_to_antibiotic |
| Publications | Selhub J, et al. 1978. J Clin Invest 61(1): 221-224. Inhibition of folate enzymes by sulfasalazine. (PMID 22555) |
| Curator | Description | Most Recent Edit |
|---|