| Ontology | CARD's Antibiotic Resistance Ontology |
| Accession | ARO:3000699 |
| Synonym(s) | sulfamethizol sulphamethizole Urolucosil |
| Definition | Sulfamethizole is a short-acting sulfonamide that inhibits dihydropteroate synthetase. |
| SMILES | Cc1nnc(NS(=O)(=O)c2ccc(N)cc2)s1 |
| PubChem | 5328 |
| ChEBI | 9331 |
| CAS | 144-82-1 |
| ChEMBL | CHEMBL1191 |
| Drug Class | sulfonamide antibiotic |
| Classification | 2 ontology terms | Show |
| Parent Term(s) | 1 ontology terms | Show + sulfonamide antibiotic [Drug Class] |
| Sub-Term(s) | 6 ontology terms | Show + antibiotic sensitive dihydropteroate synthase targeted_by_antibiotic + sul1 confers_resistance_to_antibiotic + sul2 confers_resistance_to_antibiotic + sul3 confers_resistance_to_antibiotic + Escherichia coli folP with mutation conferring resistance to sulfonamides confers_resistance_to_antibiotic + Streptococcus pyogenes folP with mutation conferring resistance to sulfonamides confers_resistance_to_antibiotic |
| Publications | Watanabe H and Hastings JW. 1990. Biochim Biophys Acta 1017(3): 229-234. Inhibition of bioluminescence in Photobacterium phosphoreum by sulfamethizole and its stimulation by thymine. (PMID 2372557) |
| Curator | Description | Most Recent Edit |
|---|