| Ontology | CARD's Antibiotic Resistance Ontology |
| Accession | ARO:3000330 |
| Definition | Sulfisoxazole is an inhibitor of dihydropteroate synthase, interfering with the tetrahydrofolic biosynthesis pathway. Tetrahydrofolic acid is essential for folate synthesis, a precursor to many nucleotides and amino acids. |
| SMILES | Cc1noc(NS(=O)(=O)c2ccc(N)cc2)c1C |
| PubChem | 5344 |
| ChEMBL | CHEMBL453 |
| ChEBI | 102484 |
| CAS | 127-69-5 |
| Drug Class | sulfonamide antibiotic |
| Classification | 2 ontology terms | Show |
| Parent Term(s) | 1 ontology terms | Show + sulfonamide antibiotic [Drug Class] |
| Sub-Term(s) | 7 ontology terms | Show + antibiotic sensitive dihydropteroate synthase targeted_by_antibiotic + sul1 confers_resistance_to_antibiotic + sul2 confers_resistance_to_antibiotic + sul3 confers_resistance_to_antibiotic + Escherichia coli folP with mutation conferring resistance to sulfonamides confers_resistance_to_antibiotic + Streptococcus pyogenes folP with mutation conferring resistance to sulfonamides confers_resistance_to_antibiotic + Neisseria gonorrhoeae folP with mutation conferring resistance to sulfonamides confers_resistance_to_antibiotic |
| Publications | Slywka GW, et al. 1976. J Pharm Sci 65(10): 1494-1498. Bioavailability of 11 sulfisoxazole products in humans. (PMID 978409) |
| Curator | Description | Most Recent Edit |
|---|