| Accession | ARO:0000003 |
| Synonym(s) | Astromicina Astromicine Astromicinum fortimicin A |
| Definition | Astromicin is an aminoglycoside antibiotic used to treat different types of bacterial infections. Astromicin works by binding to the bacterial 30S ribosomal subunit, causing misreading of mRNA and leaving the bacterium unable to synthesize proteins vital to its growth. |
| SMILES | CO[C@H]1[C@@H](O)[C@H](N)[C@@H](O[C@H]2O[C@H]([C@H](C)N)CC[C@H]2N)[C@H](O)[C@@H]1N(C)C(=O)CN |
| PubChem | 5284517 |
| ChEMBL | CHEMBL3084803 |
| ChEBI | 37923 |
| CAS | 55779-06-1 |
| Drug Class | aminoglycoside antibiotic |
| Classification | 2 ontology terms | Show |
| Parent Term(s) | 1 ontology terms | Show + aminoglycoside antibiotic [Drug Class] |
| Sub-Term(s) | 7 ontology terms | Show + antibiotic sensitive 16S rRNA targeted_by_antibiotic + AAC(3)-Id confers_resistance_to_antibiotic + rmtF confers_resistance_to_antibiotic + AAC(3)-Ib confers_resistance_to_antibiotic + AAC(3)-Ic confers_resistance_to_antibiotic + AAC(3)-Ia confers_resistance_to_antibiotic + AAC(3)-Ib/AAC(6')-Ib3 bifunctional protein confers_resistance_to_antibiotic |
| Publications | Kotra LP, et al. 2000. Antimicrob Agents Chemother 44(12): 3249-3256. Aminoglycosides: perspectives on mechanisms of action and resistance and strategies to counter resistance. (PMID 11083623) Mingeot-Leclercq MP, et al. 1999. Antimicrob Agents Chemother 43(4): 727-737. Aminoglycosides: activity and resistance. (PMID 10103173) Shaw KJ, et al. 1993. Microbiol Rev 57(1): 138-163. Molecular genetics of aminoglycoside resistance genes and familial relationships of the aminoglycoside-modifying enzymes. (PMID 8385262) |
| Curator | Description | Most Recent Edit |
|---|
