| Ontology | CARD's Antibiotic Resistance Ontology | 
| Accession | ARO:0000070 | 
| Synonym(s) | ERT Invanz | 
| Definition | Ertapenem is a carbapenem antibiotic and is highly resistant to beta-lactamases like other carbapenems. It inhibits bacterial cell wall synthesis. | 
| SMILES | C[C@@H](O)[C@H]1C(=O)N2C(C(=O)O)=C(S[C@@H]3CN[C@H](C(=O)Nc4cccc(C(=O)O)c4)C3)[C@H](C)[C@H]12 | 
| PubChem | 150610 | 
| ChEMBL | CHEMBL1359 | 
| ChEBI | 404903 | 
| CAS | 153832-46-3 | 
| Drug Class | carbapenem | 
| Classification | 3 ontology terms | Show | 
| Parent Term(s) | 1 ontology terms  | Show + carbapenem [Drug Class] | 
| Sub-Term(s) | 10 ontology terms  | Show + beta-lactam sensitive penicillin-binding protein  targeted_by_antibiotic + Klebsiella pneumoniae KpnGH-TolC confers_resistance_to_antibiotic + NDM-1 confers_resistance_to_antibiotic + NDM-5 confers_resistance_to_antibiotic + CTX-M-27 confers_resistance_to_antibiotic + CMY-2 confers_resistance_to_antibiotic + Klebsiella pneumoniae OmpK35 confers_resistance_to_antibiotic + VIM-63 confers_resistance_to_antibiotic + VCC-1 confers_resistance_to_antibiotic + FRI-11 confers_resistance_to_antibiotic | 
| Publications | Shah PM and Isaacs RD. 2003. J Antimicrob Chemother 52(4): 538-542. Ertapenem, the first of a new group of carbapenems. (PMID 12951340) Sakoulas G, et al. 2016. Antimicrob. Agents Chemother. : Cefazolin and Ertapenem: A Synergistic Combination Used to Clear Persistent Staphylococcus aureus Bacteremia. (PMID 27572414) | 
| Curator | Description | Most Recent Edit | 
|---|