| Ontology | CARD's Antibiotic Resistance Ontology |
| Accession | ARO:3007048 |
| Synonym(s) | QPX7728 |
| Definition | Xeruborbactam is an experimental cyclic boronate ultrabroad-spectrum beta-lactamase inhibitor, with potent activity against both serine beta-lactamases and metallo-beta-lactamases. |
| SMILES | O=C(O)c1c(F)ccc2c1OB(O)[C@@H]1C[C@H]21 |
| PubChem | 140830474 |
| ChEMBL | CHEMBL4633785 |
| AMR Gene Family | OXA beta-lactamase, OXA-48-like beta-lactamase, OXA-23-like beta-lactamase, KPC beta-lactamase, CTX-M beta-lactamase, SHV beta-lactamase, TEM beta-lactamase |
| Drug Class | penicillin beta-lactam, cephalosporin, carbapenem, monobactam |
| Resistance Mechanism | antibiotic inactivation |
| Classification | 39 ontology terms | Show + process or component of antibiotic biology or chemistry + antibiotic molecule + mechanism of antibiotic resistance + beta-lactam antibiotic + determinant of antibiotic resistance + antibiotic inactivation [Resistance Mechanism] + antibiotic inactivation enzyme + hydrolysis of antibiotic conferring resistance + penicillin beta-lactam [Drug Class] + beta-lactamase resistant penicillin + hydrolysis of beta-lactam antibiotic by serine beta-lactamase + beta-lactamase + resistance-modifying agents + penicillin with extended spectrum + inhibitor of antibiotic resistance mechanism + class A beta-lactamase + class D beta-lactamase + oxacillin [Antibiotic] + cephalosporin [Drug Class] + third-generation cephalosporin + first-generation cephalosporin + ampicillin [Antibiotic] + SHV-LEN beta-lactamase + beta-lactamase inhibitor + OXA beta-lactamase [AMR Gene Family] + carbapenem [Drug Class] + monobactam [Drug Class] + OXA-48-like beta-lactamase [AMR Gene Family] + OXA-23-like beta-lactamase [AMR Gene Family] + serine beta-lactamase inhibitor + temocillin [Antibiotic] + cefalotin [Antibiotic] + KPC beta-lactamase [AMR Gene Family] + CTX-M beta-lactamase [AMR Gene Family] + SHV beta-lactamase [AMR Gene Family] + TEM beta-lactamase [AMR Gene Family] + ceftriaxone [Antibiotic] + ceftazidime [Antibiotic] + cefazolin [Antibiotic] |
| Parent Term(s) | 8 ontology terms | Show + is_small_molecule_inhibitor_of TEM-10 + is_small_molecule_inhibitor_of SHV-12 + is_small_molecule_inhibitor_of OXA-23 + is_small_molecule_inhibitor_of OXA-48 + is_small_molecule_inhibitor_of CTX-M-14 + is_small_molecule_inhibitor_of CTX-M-15 + is_small_molecule_inhibitor_of KPC-2 + boronic acid beta-lactamase inhibitor |
| Publications | Lomovskaya O, et al. 2022. Antimicrob Agents Chemother 66(2):e0216821 The Ultrabroad-Spectrum Beta-Lactamase Inhibitor QPX7728 Restores the Potency of Multiple Oral Beta-Lactam Antibiotics against Beta-Lactamase-Producing Strains of Resistant Enterobacterales. (PMID 34902261) |
| Curator | Description | Most Recent Edit |
|---|