| Ontology | CARD's Antibiotic Resistance Ontology |
| Accession | ARO:3000654 |
| Synonym(s) | habekacin haberacin |
| Definition | A synthetic derivative (1-N-(4-amino-2-hydroxybutyryl) of dibekacin used in Japan. It is active against methicillin-resistant Staph. aureus and shows synergy with ampicillin when treating gentamicin and vancomycin resistant enterocci. |
| SMILES | NCC[C@H](O)C(=O)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)CC[C@H]2N)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](N)[C@H]1O |
| PubChem | 68682 |
| ChEBI | 37922 |
| CAS | 51025-85-5 |
| ChEMBL | CHEMBL426926 |
| Drug Class | aminoglycoside antibiotic |
| Classification | 2 ontology terms | Show |
| Parent Term(s) | 1 ontology terms | Show + aminoglycoside antibiotic [Drug Class] |
| Sub-Term(s) | 10 ontology terms | Show + antibiotic sensitive 16S rRNA targeted_by_antibiotic + armA confers_resistance_to_antibiotic + rmtA confers_resistance_to_antibiotic + rmtB confers_resistance_to_antibiotic + rmtC confers_resistance_to_antibiotic + sgm confers_resistance_to_antibiotic + MexXY-OprA confers_resistance_to_antibiotic + rmtD confers_resistance_to_antibiotic + rmtG confers_resistance_to_antibiotic + rmtH confers_resistance_to_antibiotic |
| Publications | Akins RL and Rybak MJ. 2000. Antimicrob Agents Chemother 44(7): 1925-1929. In vitro activities of daptomycin, arbekacin, vancomycin, and gentamicin alone and/or in combination against glycopeptide intermediate-resistant Staphylococcus aureus in an infection model. (PMID 10858356) Hamilton-Miller JM and Shah S. 1995. J Antimicrob Chemother 35(6): 865-868. Activity of the semi-synthetic kanamycin B derivative, arbekacin against methicillin-resistant Staphylococcus aureus. (PMID 7559197) |
| Curator | Description | Most Recent Edit |
|---|