Ontology | CARD's Antibiotic Resistance Ontology |
Accession | ARO:3000461 |
Definition | Florfenicol is a fluorine derivative of chloramphenicol, where the nitro group (-NO2) is substituted by a sulfomethyl group (-SO2CH3) and the hydroxyl group (-OH), by a fluorine group (-F). The action mechanism is the same as chloramphenicol's, where the antibiotic binds to the 23S RNA of the 50S subunit of bacterial ribosomes to inhibit protein synthesis. |
SMILES | CS(=O)(=O)c1ccc([C@@H](O)[C@@H](CF)NC(=O)C(Cl)Cl)cc1 |
PubChem | 114811 |
ChEMBL | CHEMBL1241590 |
ChEBI | 87185 |
CAS | 73231-34-2 |
Drug Class | phenicol antibiotic |
Classification | 2 ontology terms | Show |
Parent Term(s) | 1 ontology terms | Show + phenicol antibiotic [Drug Class] |
Sub-Term(s) | 12 ontology terms | Show + antibiotic sensitive peptidyl transferase (23S rRNA) targeted_by_antibiotic + clcD confers_resistance_to_antibiotic + floR confers_resistance_to_antibiotic + pp-flo confers_resistance_to_antibiotic + fexA confers_resistance_to_antibiotic + flo confers_resistance_to_antibiotic + Staphylococcus aureus LmrS confers_resistance_to_antibiotic + cfrC confers_resistance_to_antibiotic + poxtA confers_resistance_to_antibiotic + pexA confers_resistance_to_antibiotic + fexB confers_resistance_to_antibiotic + optrA confers_resistance_to_antibiotic |
Publications | Schwarz S, et al. 2004. FEMS Microbiol Rev 28(5): 519-542. Molecular basis of bacterial resistance to chloramphenicol and florfenicol. (PMID 15539072) |
Curator | Description | Most Recent Edit |
---|