vaborbactam [Adjuvant]

Download Sequences


Ontology CARD's Antibiotic Resistance Ontology
Accession ARO:3004380
DefinitionAntibiotic adjuvant and serine beta-lactamase inhibitor, often paired with meropenem for clinical use.
SMILESO=C(O)C[C@@H]1CC[C@H](NC(=O)Cc2cccs2)B(O)O1
PubChem56649692
ChEMBLCHEMBL3317857
AMR Gene FamilyCMY beta-lactamase, DHA beta-lactamase, KPC beta-lactamase, MIR beta-lactamase, SME beta-lactamase, IMI beta-lactamase, CTX-M beta-lactamase, SHV beta-lactamase
Drug Classazole antibiotic, penicillin beta-lactam, cephalosporin, imidazole antibiotic, carbapenem, monobactam
Resistance Mechanismantibiotic inactivation
Classification46 ontology terms | Show
+ process or component of antibiotic biology or chemistry
+ mechanism of antibiotic resistance
+ determinant of antibiotic resistance
+ antibiotic inactivation [Resistance Mechanism]
+ antibiotic inactivation enzyme
+ hydrolysis of antibiotic conferring resistance
+ hydrolysis of beta-lactam antibiotic by serine beta-lactamase
+ beta-lactamase
+ antibiotic molecule
+ class C beta-lactamase
+ beta-lactam antibiotic
+ resistance-modifying agents
+ azole antibiotic [Drug Class]
+ inhibitor of antibiotic resistance mechanism
+ CMY-LAT-MOX beta-lactamase
+ class A beta-lactamase
+ penicillin beta-lactam [Drug Class]
+ cephalosporin [Drug Class]
+ penicillin with extended spectrum
+ third-generation cephalosporin [Drug Subclass]
+ second-generation cephalosporin [Drug Subclass]
+ first-generation cephalosporin [Drug Subclass]
+ imidazole antibiotic [Drug Class]
+ SHV-LEN beta-lactamase
+ CMY-MOX beta-lactamase
+ CMY-LAT beta-lactamase
+ beta-lactamase inhibitor
+ carbapenem [Drug Class]
+ monobactam [Drug Class]
+ serine beta-lactamase inhibitor
+ cefalotin [Antibiotic]
+ cefixime [Antibiotic]
+ ampicillin [Antibiotic]
+ CMY beta-lactamase [AMR Gene Family]
+ DHA beta-lactamase [AMR Gene Family]
+ KPC beta-lactamase [AMR Gene Family]
+ MIR beta-lactamase [AMR Gene Family]
+ SME beta-lactamase [AMR Gene Family]
+ IMI beta-lactamase [AMR Gene Family]
+ CTX-M beta-lactamase [AMR Gene Family]
+ SHV beta-lactamase [AMR Gene Family]
+ ertapenem [Antibiotic]
+ ceftriaxone [Antibiotic]
+ ceftazidime [Antibiotic]
+ cefazolin [Antibiotic]
+ cefoxitin [Antibiotic]
Parent Term(s)13 ontology terms | Show
+ is_small_molecule_inhibitor_of SHV-5
+ is_small_molecule_inhibitor_of SHV-18
+ is_small_molecule_inhibitor_of CTX-M-3
+ is_small_molecule_inhibitor_of CTX-M-14
+ is_small_molecule_inhibitor_of CTX-M-15
+ is_small_molecule_inhibitor_of CMY-2
+ is_small_molecule_inhibitor_of DHA-1
+ is_small_molecule_inhibitor_of MIR-1
+ is_small_molecule_inhibitor_of KPC-2
+ is_small_molecule_inhibitor_of KPC-3
+ is_small_molecule_inhibitor_of SME-2
+ is_small_molecule_inhibitor_of NmcA
+ boronic acid beta-lactamase inhibitor
Sub-Term(s)
1 ontology terms | Show
+ meropenem-vaborbactam [Antibiotic+Adjuvant] has_part
Publications

Bush K, et al. 2018. ACS Infect Dis 4(2):84-87 Game Changers: New β-Lactamase Inhibitor Combinations Targeting Antibiotic Resistance in Gram-Negative Bacteria. (PMID 29232103)

Curator Acknowledgements
Curator Description Most Recent Edit