Ontology | CARD's Antibiotic Resistance Ontology |
Accession | ARO:3004380 |
Definition | Antibiotic adjuvant and serine beta-lactamase inhibitor, often paired with meropenem for clinical use. |
SMILES | O=C(O)C[C@@H]1CC[C@H](NC(=O)Cc2cccs2)B(O)O1 |
PubChem | 56649692 |
ChEMBL | CHEMBL3317857 |
Classification | 5 ontology terms | Show |
Parent Term(s) | 13 ontology terms | Show + is_small_molecule_inhibitor_of SHV-5 + is_small_molecule_inhibitor_of SHV-18 + is_small_molecule_inhibitor_of CTX-M-3 + is_small_molecule_inhibitor_of CTX-M-14 + is_small_molecule_inhibitor_of CTX-M-15 + is_small_molecule_inhibitor_of CMY-2 + is_small_molecule_inhibitor_of DHA-1 + is_small_molecule_inhibitor_of MIR-1 + is_small_molecule_inhibitor_of KPC-2 + is_small_molecule_inhibitor_of KPC-3 + is_small_molecule_inhibitor_of SME-2 + is_small_molecule_inhibitor_of NmcA + boronic acid beta-lactamase inhibitor |
Sub-Term(s) | 1 ontology terms | Show + meropenem-vaborbactam [Antibiotic+Adjuvant] has_part |
Publications | Bush K, et al. 2018. ACS Infect Dis 4(2):84-87 Game Changers: New β-Lactamase Inhibitor Combinations Targeting Antibiotic Resistance in Gram-Negative Bacteria. (PMID 29232103) |
Curator | Description | Most Recent Edit |
---|