| Ontology | CARD's Antibiotic Resistance Ontology |
| Accession | ARO:3004380 |
| Definition | Antibiotic adjuvant and serine beta-lactamase inhibitor, often paired with meropenem for clinical use. |
| SMILES | O=C(O)C[C@@H]1CC[C@H](NC(=O)Cc2cccs2)B(O)O1 |
| PubChem | 56649692 |
| ChEMBL | CHEMBL3317857 |
| AMR Gene Family | CMY beta-lactamase, DHA beta-lactamase, KPC beta-lactamase, MIR beta-lactamase, SME beta-lactamase, IMI beta-lactamase, CTX-M beta-lactamase, SHV beta-lactamase |
| Drug Class | azole antibiotic, penicillin beta-lactam, cephalosporin, imidazole antibiotic, carbapenem, monobactam |
| Resistance Mechanism | antibiotic inactivation |
| Classification | 46 ontology terms | Show + process or component of antibiotic biology or chemistry + mechanism of antibiotic resistance + determinant of antibiotic resistance + antibiotic inactivation [Resistance Mechanism] + antibiotic inactivation enzyme + hydrolysis of antibiotic conferring resistance + hydrolysis of beta-lactam antibiotic by serine beta-lactamase + beta-lactamase + antibiotic molecule + class C beta-lactamase + beta-lactam antibiotic + resistance-modifying agents + azole antibiotic [Drug Class] + inhibitor of antibiotic resistance mechanism + CMY-LAT-MOX beta-lactamase + class A beta-lactamase + penicillin beta-lactam [Drug Class] + cephalosporin [Drug Class] + penicillin with extended spectrum + third-generation cephalosporin [Drug Subclass] + second-generation cephalosporin [Drug Subclass] + first-generation cephalosporin [Drug Subclass] + imidazole antibiotic [Drug Class] + SHV-LEN beta-lactamase + CMY-MOX beta-lactamase + CMY-LAT beta-lactamase + beta-lactamase inhibitor + carbapenem [Drug Class] + monobactam [Drug Class] + serine beta-lactamase inhibitor + cefalotin [Antibiotic] + cefixime [Antibiotic] + ampicillin [Antibiotic] + CMY beta-lactamase [AMR Gene Family] + DHA beta-lactamase [AMR Gene Family] + KPC beta-lactamase [AMR Gene Family] + MIR beta-lactamase [AMR Gene Family] + SME beta-lactamase [AMR Gene Family] + IMI beta-lactamase [AMR Gene Family] + CTX-M beta-lactamase [AMR Gene Family] + SHV beta-lactamase [AMR Gene Family] + ertapenem [Antibiotic] + ceftriaxone [Antibiotic] + ceftazidime [Antibiotic] + cefazolin [Antibiotic] + cefoxitin [Antibiotic] |
| Parent Term(s) | 13 ontology terms | Show + is_small_molecule_inhibitor_of SHV-5 + is_small_molecule_inhibitor_of SHV-18 + is_small_molecule_inhibitor_of CTX-M-3 + is_small_molecule_inhibitor_of CTX-M-14 + is_small_molecule_inhibitor_of CTX-M-15 + is_small_molecule_inhibitor_of CMY-2 + is_small_molecule_inhibitor_of DHA-1 + is_small_molecule_inhibitor_of MIR-1 + is_small_molecule_inhibitor_of KPC-2 + is_small_molecule_inhibitor_of KPC-3 + is_small_molecule_inhibitor_of SME-2 + is_small_molecule_inhibitor_of NmcA + boronic acid beta-lactamase inhibitor |
| Sub-Term(s) | 1 ontology terms | Show + meropenem-vaborbactam [Antibiotic+Adjuvant] has_part |
| Publications | Bush K, et al. 2018. ACS Infect Dis 4(2):84-87 Game Changers: New β-Lactamase Inhibitor Combinations Targeting Antibiotic Resistance in Gram-Negative Bacteria. (PMID 29232103) |
| Curator | Description | Most Recent Edit |
|---|