| Ontology | CARD's Antibiotic Resistance Ontology |
| Accession | ARO:3007094 |
| Synonym(s) | Cotinin Fustel Viset |
| Definition | Fisetin is a flavonoid produced mainly by plants in the Eudicotidae clade. It exhibits a range of biological activities such as anti-inflammatory and antioxidant properties, and fisetin has been shown to inhibit the action of metallo-beta-lactamases. |
| SMILES | O=c1c(O)c(-c2ccc(O)c(O)c2)oc2cc(O)ccc12 |
| PubChem | 5281614 |
| ChEBI | 42567 |
| ChEMBL | CHEMBL31574 |
| CAS | 528-48-3 |
| AMR Gene Family | NDM beta-lactamase |
| Drug Class | penicillin beta-lactam, cephalosporin, carbapenem |
| Resistance Mechanism | antibiotic inactivation |
| Classification | 23 ontology terms | Show + process or component of antibiotic biology or chemistry + mechanism of antibiotic resistance + determinant of antibiotic resistance + antibiotic inactivation [Resistance Mechanism] + antibiotic inactivation enzyme + hydrolysis of antibiotic conferring resistance + hydrolysis of beta-lactam antibiotic by metallo-beta-lactamase + beta-lactamase + antibiotic molecule + resistance-modifying agents + inhibitor of antibiotic resistance mechanism + beta-lactam antibiotic + class B (metallo-) beta-lactamase + subclass B1 (metallo-) beta-lactamase + beta-lactamase inhibitor + penicillin beta-lactam [Drug Class] + cephalosporin [Drug Class] + carbapenem [Drug Class] + metallo-beta-lactamase inhibitor + imipenem [Antibiotic] + NDM beta-lactamase [AMR Gene Family] + meropenem [Antibiotic] + ertapenem [Antibiotic] |
| Parent Term(s) | 2 ontology terms | Show |
| Publications | Guo Y, et al. 2022. Eur J Med Chem 231:114108 Metallo-β-lactamases inhibitor fisetin attenuates meropenem resistance in NDM-1-producing Escherichia coli. (PMID 35101651) |
| Curator | Description | Most Recent Edit |
|---|