taniborbactam [Adjuvant]

Download Sequences


Ontology CARD's Antibiotic Resistance Ontology
Accession ARO:3007147
Synonym(s)VNRX-5133
DefinitionTaniborbactam is a broad-spectrum beta-lactamase inhibitor. As of 2022, it is in phase III clinical trials in combination with cefepime and is the only beta-lactamase inhibitor exhibiting activity against all four classes of beta-lactamase.
SMILESNCCN[C@H]1CC[C@@H](CC(=O)N[C@H]2Cc3cccc(C(=O)O)c3OB2O)CC1
PubChem76902493
ChEMBLCHEMBL4584705
AMR Gene FamilyOXA beta-lactamase, OXA-48-like beta-lactamase, OXA-1-like beta-lactamase, CMY beta-lactamase, KPC beta-lactamase, NDM beta-lactamase, VIM beta-lactamase, IMP beta-lactamase, CTX-M beta-lactamase, SHV beta-lactamase
Drug Classpenicillin beta-lactam, cephalosporin, carbapenem, monobactam
Resistance Mechanismantibiotic inactivation
Classification56 ontology terms | Show
+ process or component of antibiotic biology or chemistry
+ mechanism of antibiotic resistance
+ determinant of antibiotic resistance
+ antibiotic molecule
+ antibiotic inactivation [Resistance Mechanism]
+ antibiotic inactivation enzyme
+ hydrolysis of antibiotic conferring resistance
+ beta-lactam antibiotic
+ hydrolysis of beta-lactam antibiotic by serine beta-lactamase
+ penicillin beta-lactam [Drug Class]
+ beta-lactamase
+ beta-lactamase resistant penicillin
+ hydrolysis of beta-lactam antibiotic by metallo-beta-lactamase
+ class C beta-lactamase
+ resistance-modifying agents
+ inhibitor of antibiotic resistance mechanism
+ CMY-LAT-MOX beta-lactamase
+ class A beta-lactamase
+ class D beta-lactamase
+ class B (metallo-) beta-lactamase
+ oxacillin [Antibiotic]
+ cephalosporin [Drug Class]
+ penicillin with extended spectrum
+ third-generation cephalosporin
+ second-generation cephalosporin
+ first-generation cephalosporin
+ subclass B1 (metallo-) beta-lactamase
+ SHV-LEN beta-lactamase
+ CMY-MOX beta-lactamase
+ CMY-LAT beta-lactamase
+ beta-lactamase inhibitor
+ OXA beta-lactamase [AMR Gene Family]
+ carbapenem [Drug Class]
+ monobactam [Drug Class]
+ OXA-48-like beta-lactamase [AMR Gene Family]
+ OXA-1-like beta-lactamase [AMR Gene Family]
+ metallo-beta-lactamase inhibitor
+ serine beta-lactamase inhibitor
+ temocillin [Antibiotic]
+ cefalotin [Antibiotic]
+ cefixime [Antibiotic]
+ ampicillin [Antibiotic]
+ CMY beta-lactamase [AMR Gene Family]
+ KPC beta-lactamase [AMR Gene Family]
+ NDM beta-lactamase [AMR Gene Family]
+ VIM beta-lactamase [AMR Gene Family]
+ IMP beta-lactamase [AMR Gene Family]
+ CTX-M beta-lactamase [AMR Gene Family]
+ SHV beta-lactamase [AMR Gene Family]
+ piperacillin [Antibiotic]
+ ertapenem [Antibiotic]
+ amoxicillin [Antibiotic]
+ ceftriaxone [Antibiotic]
+ ceftazidime [Antibiotic]
+ cefazolin [Antibiotic]
+ cefoxitin [Antibiotic]
Parent Term(s)11 ontology terms | Show
+ is_small_molecule_inhibitor_of NDM-2
+ is_small_molecule_inhibitor_of SHV-5
+ is_small_molecule_inhibitor_of OXA-1
+ is_small_molecule_inhibitor_of OXA-48
+ is_small_molecule_inhibitor_of CTX-M-15
+ is_small_molecule_inhibitor_of CMY-2
+ is_small_molecule_inhibitor_of IMP-1
+ is_small_molecule_inhibitor_of VIM-2
+ is_small_molecule_inhibitor_of KPC-2
+ boronic acid beta-lactamase inhibitor
+ unclassified metallo-beta-lactamase inhibitor
Sub-Term(s)
1 ontology terms | Show
+ cefepime-taniborbactam [Antibiotic+Adjuvant] has_part
Publications

Hamrick JC, et al. 2020. Antimicrob Agents Chemother 64(3): VNRX-5133 (Taniborbactam), a Broad-Spectrum Inhibitor of Serine- and Metallo-β-Lactamases, Restores Activity of Cefepime in Enterobacterales and Pseudomonas aeruginosa. (PMID 31871094)

Curator Acknowledgements
Curator Description Most Recent Edit