| Ontology | CARD's Antibiotic Resistance Ontology |
| Accession | ARO:3007293 |
| Synonym(s) | ETX-2514 |
| Definition | Durlobactam is a broad-spectrum diazabicyclooctane beta-lactamase inhibitor capable to inhibiting class A, C, and D beta-lactamases. |
| SMILES | CC1=C[C@@H]2CN(C(=O)N2OS(=O)(=O)O)[C@@H]1C(N)=O |
| PubChem | 89851852 |
| CHEBI | 229539 |
| ChEMBL | CHEMBL4298137 |
| AMR Gene Family | OXA-24-like beta-lactamase, KPC beta-lactamase |
| Drug Class | penicillin beta-lactam, cephalosporin, carbapenem, monobactam |
| Resistance Mechanism | antibiotic inactivation |
| Classification | 26 ontology terms | Show + process or component of antibiotic biology or chemistry + antibiotic molecule + mechanism of antibiotic resistance + beta-lactam antibiotic + determinant of antibiotic resistance + antibiotic inactivation [Resistance Mechanism] + antibiotic inactivation enzyme + hydrolysis of antibiotic conferring resistance + penicillin beta-lactam [Drug Class] + beta-lactamase resistant penicillin + hydrolysis of beta-lactam antibiotic by serine beta-lactamase + beta-lactamase + resistance-modifying agents + inhibitor of antibiotic resistance mechanism + class D beta-lactamase + oxacillin [Antibiotic] + class A beta-lactamase + beta-lactamase inhibitor + OXA beta-lactamase + cephalosporin [Drug Class] + carbapenem [Drug Class] + monobactam [Drug Class] + OXA-24-like beta-lactamase [AMR Gene Family] + serine beta-lactamase inhibitor + BAL30072 [Antibiotic] + KPC beta-lactamase [AMR Gene Family] |
| Parent Term(s) | 3 ontology terms | Show |
| Sub-Term(s) | 2 ontology terms | Show + sulbactam-durlobactam [Antibiotic+Adjuvant] has_part + Escherichia coli PBP2-like mrdA with mutation conferring resistance to durlobactam confers_resistance_to_antibiotic |
| Publications | Shapiro AB, et al. 2021. Front Microbiol 12:709974 Durlobactam, a New Diazabicyclooctane β-Lactamase Inhibitor for the Treatment of Acinetobacter Infections in Combination With Sulbactam. (PMID 34349751) |
| Curator | Description | Most Recent Edit |
|---|