| Ontology | CARD's Antibiotic Resistance Ontology |
| Accession | ARO:0000028 |
| Synonym(s) | Vancocin |
| Definition | Vancomycin is a glycopeptide antibiotic used in the prophylaxis and treatment of infections caused by Gram-positive bacteria. Vancomycin inhibits the synthesis of peptidoglycan, the major component of the cell wall of gram-positive bacteria. Its mechanism of action is unusual in that it acts by binding precursors of peptidoglycan, rather than by interacting with an enzyme. |
| SMILES | CN[C@H](CC(C)C)C(=O)N[C@H]1C(=O)N[C@@H](CC(N)=O)C(=O)N[C@H]2C(=O)N[C@H]3C(=O)N[C@H](C(=O)N[C@H](C(=O)O)c4cc(O)cc(O)c4-c4cc3ccc4O)[C@H](O)c3ccc(c(Cl)c3)Oc3cc2cc(c3O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[C@H]2C[C@](C)(N)[C@H](O)[C@H](C)O2)Oc2ccc(cc2Cl)[C@H]1O |
| PubChem | 14969 |
| ChEMBL | CHEMBL262777 |
| ChEBI | 28001 |
| Drug Class | glycopeptide antibiotic |
| Classification | 2 ontology terms | Show |
| Parent Term(s) | 1 ontology terms | Show + glycopeptide antibiotic [Drug Class] |
| Sub-Term(s) | 22 ontology terms | Show + acyl-D-alanyl-D-alanine targeted_by_antibiotic + glycopeptide resistance gene cluster VanA confers_resistance_to_antibiotic + Clostridioides difficile rpoC with mutation conferring resistance to vancomycin confers_resistance_to_antibiotic + murG transferase [AMR Gene Family] confers_resistance_to_antibiotic + D-Ala-D-Ala ligase confers_resistance_to_antibiotic + cfr(D) confers_resistance_to_antibiotic + Clostridioides difficile murG with mutation conferring resistance to vancomycin confers_resistance_to_antibiotic + glycopeptide resistance gene cluster VanB confers_resistance_to_antibiotic + glycopeptide resistance gene cluster VanE confers_resistance_to_antibiotic + glycopeptide resistance gene cluster VanG confers_resistance_to_antibiotic + glycopeptide resistance gene cluster VanD confers_resistance_to_antibiotic + glycopeptide resistance gene cluster VanF confers_resistance_to_antibiotic + glycopeptide resistance gene cluster VanI confers_resistance_to_antibiotic + glycopeptide resistance gene cluster VanL confers_resistance_to_antibiotic + glycopeptide resistance gene cluster VanM confers_resistance_to_antibiotic + glycopeptide resistance gene cluster VanN confers_resistance_to_antibiotic + glycopeptide resistance gene cluster VanO confers_resistance_to_antibiotic + glycopeptide resistance gene cluster VanC confers_resistance_to_antibiotic + glycopeptide resistance gene cluster vanP confers_resistance_to_antibiotic + YajC confers_resistance_to_antibiotic + mlaFEDB confers_resistance_to_antibiotic + VRA-F confers_resistance_to_antibiotic |
| Publications | Courvalin P. 2005. Clin Infect Dis 42(SUPPL 1): S25-S34. Vancomycin resistance in gram-positive cocci. (PMID 16323116) |
| Curator | Description | Most Recent Edit |
|---|
