Ontology | CARD's Antibiotic Resistance Ontology |
Accession | ARO:3000667 |
Synonym(s) | declomycin DMCTC |
Definition | Demeclocycline is a tetracycline analog with 7-chloro and 6-methyl groups. Due to its fast absorption and slow excretion, it maintains higher effective blood levels compared to other tetracyclines. |
SMILES | CN(C)[C@@H]1C(O)=C(C(N)=O)C(=O)[C@@]2(O)C(O)=C3C(=O)c4c(O)ccc(Cl)c4[C@@H](O)[C@H]3C[C@@H]12 |
PubChem | 54680690 |
ChEBI | 4392 |
CAS | 127-33-3 |
ChEMBL | CHEMBL1591 |
Drug Class | tetracycline antibiotic |
Classification | 2 ontology terms | Show |
Parent Term(s) | 1 ontology terms | Show + tetracycline antibiotic [Drug Class] |
Sub-Term(s) | 13 ontology terms | Show + antibiotic sensitive 16S rRNA targeted_by_antibiotic + tet(X) confers_resistance_to_antibiotic + tet(32) confers_resistance_to_antibiotic + tet(36) confers_resistance_to_antibiotic + tetB(P) confers_resistance_to_antibiotic + tet(Q) confers_resistance_to_antibiotic + tet(S) confers_resistance_to_antibiotic + tet(T) confers_resistance_to_antibiotic + tet(W) confers_resistance_to_antibiotic + tet(M) confers_resistance_to_antibiotic + tet(O) confers_resistance_to_antibiotic + tet(44) confers_resistance_to_antibiotic + lmrP confers_resistance_to_antibiotic |
Publications | De Troyer A. 1977. JAMA 237(25): 2723-2726. Demeclocycline. Treatment for syndrome of inappropriate antidiuretic hormone secretion. (PMID 194065) |
Curator | Description | Most Recent Edit |
---|