| Ontology | CARD's Antibiotic Resistance Ontology |
| Accession | ARO:0000069 |
| Synonym(s) | Azudoxat Deoxymykoin Doxiciclina Doxitard Doxycyclinum Doxytetracycline Vibramycin Vibramycine Vibravenos |
| Definition | Doxycycline is second generation semi-synthetic derivative of the tetracycline group of antibiotics. It inhibits bacterial protein synthesis by binding to the 30S subunit of the bacterial ribosome and preventing the aminotransferase-tRNA from associating with the ribosome. |
| SMILES | C[C@H]1c2cccc(O)c2C(=O)C2=C(O)[C@]3(O)C(=O)C(C(N)=O)=C(O)[C@@H](N(C)C)[C@@H]3[C@@H](O)[C@@H]21.O |
| PubChem | 54671203 |
| ChEBI | 50845 |
| CAS | 564-25-0 |
| ChEMBL | CHEMBL1200699 |
| Drug Class | tetracycline antibiotic |
| Classification | 2 ontology terms | Show |
| Parent Term(s) | 1 ontology terms | Show + tetracycline antibiotic [Drug Class] |
| Sub-Term(s) | 16 ontology terms | Show + antibiotic sensitive 16S rRNA targeted_by_antibiotic + tet(X) confers_resistance_to_antibiotic + tet(32) confers_resistance_to_antibiotic + tet(36) confers_resistance_to_antibiotic + tetB(P) confers_resistance_to_antibiotic + tet(Q) confers_resistance_to_antibiotic + tet(S) confers_resistance_to_antibiotic + tet(T) confers_resistance_to_antibiotic + tet(W) confers_resistance_to_antibiotic + tet(M) confers_resistance_to_antibiotic + tet(O) confers_resistance_to_antibiotic + tet(44) confers_resistance_to_antibiotic + poxtA confers_resistance_to_antibiotic + tet(61) confers_resistance_to_antibiotic + tet(63) confers_resistance_to_antibiotic + tet(64) confers_resistance_to_antibiotic |
| Publications | Chopra I and Roberts M. 2001. Microbiol Mol Biol Rev 65(2): 232-260. Tetracycline antibiotics: mode of action, applications, molecular biology, and epidemiology of bacterial resistance. (PMID 11381101) Thaker M, et al. 2010. Cell Mol Life Sci 67(3): 419-431. The tetracycline resistome. (PMID 19862477) |
| Curator | Description | Most Recent Edit |
|---|