| Ontology | CARD's Antibiotic Resistance Ontology |
| Accession | ARO:3000588 |
| Synonym(s) | NXL-104 |
| Definition | Serine beta-lactamase inhibitor targeting class A, class C, and some class D enzymes. |
| SMILES | NC(=O)[C@@H]1CC[C@@H]2CN1C(=O)N2OS(=O)(=O)O |
| PubChem | 24944097 |
| ChEBI | 85984 |
| CAS | 1192500-31-4 |
| ChEMBL | CHEMBL1689063 |
| AMR Gene Family | OXA beta-lactamase, OXA-1-like beta-lactamase, class A Mycobacterium abscessus beta-lactamase, MOX beta-lactamase, ACT beta-lactamase, CMY beta-lactamase, KPC beta-lactamase, IMP beta-lactamase, CTX-M beta-lactamase, SHV beta-lactamase, TEM beta-lactamase |
| Drug Class | penicillin beta-lactam, cephalosporin, carbapenem, monobactam |
| Resistance Mechanism | antibiotic inactivation |
| Classification | 56 ontology terms | Show + process or component of antibiotic biology or chemistry + mechanism of antibiotic resistance + determinant of antibiotic resistance + antibiotic molecule + antibiotic inactivation [Resistance Mechanism] + antibiotic inactivation enzyme + hydrolysis of antibiotic conferring resistance + beta-lactam antibiotic + hydrolysis of beta-lactam antibiotic by serine beta-lactamase + penicillin beta-lactam [Drug Class] + beta-lactamase + beta-lactamase resistant penicillin + hydrolysis of beta-lactam antibiotic by metallo-beta-lactamase + class C beta-lactamase + resistance-modifying agents + penicillin with extended spectrum + inhibitor of antibiotic resistance mechanism + CMY-LAT-MOX beta-lactamase + class A beta-lactamase + class D beta-lactamase + class B (metallo-) beta-lactamase + oxacillin [Antibiotic] + cephalosporin [Drug Class] + third-generation cephalosporin + second-generation cephalosporin + first-generation cephalosporin + ampicillin [Antibiotic] + subclass B1 (metallo-) beta-lactamase + SHV-LEN beta-lactamase + CMY-MOX beta-lactamase + CMY-LAT beta-lactamase + beta-lactamase inhibitor + OXA beta-lactamase [AMR Gene Family] + carbapenem [Drug Class] + monobactam [Drug Class] + OXA-1-like beta-lactamase [AMR Gene Family] + class A Mycobacterium abscessus beta-lactamase [AMR Gene Family] + serine beta-lactamase inhibitor + ticarcillin [Antibiotic] + cefalotin [Antibiotic] + cefixime [Antibiotic] + MOX beta-lactamase [AMR Gene Family] + ACT beta-lactamase [AMR Gene Family] + CMY beta-lactamase [AMR Gene Family] + KPC beta-lactamase [AMR Gene Family] + IMP beta-lactamase [AMR Gene Family] + CTX-M beta-lactamase [AMR Gene Family] + SHV beta-lactamase [AMR Gene Family] + TEM beta-lactamase [AMR Gene Family] + piperacillin [Antibiotic] + ertapenem [Antibiotic] + amoxicillin [Antibiotic] + cefuroxime [Antibiotic] + ceftriaxone [Antibiotic] + ceftazidime [Antibiotic] + cefazolin [Antibiotic] |
| Parent Term(s) | 29 ontology terms | Show + is_small_molecule_inhibitor_of TEM-1 + is_small_molecule_inhibitor_of TEM-3 + is_small_molecule_inhibitor_of TEM-9 + is_small_molecule_inhibitor_of TEM-10 + is_small_molecule_inhibitor_of TEM-12 + is_small_molecule_inhibitor_of TEM-26 + is_small_molecule_inhibitor_of TEM-28 + is_small_molecule_inhibitor_of TEM-71 + is_small_molecule_inhibitor_of SHV-1 + is_small_molecule_inhibitor_of SHV-2 + is_small_molecule_inhibitor_of SHV-3 + is_small_molecule_inhibitor_of SHV-4 + is_small_molecule_inhibitor_of SHV-7 + is_small_molecule_inhibitor_of SHV-18 + is_small_molecule_inhibitor_of SHV-52 + is_small_molecule_inhibitor_of OXA-1 + is_small_molecule_inhibitor_of ACT-1 + is_small_molecule_inhibitor_of CTX-M-15 + is_small_molecule_inhibitor_of CTX-M-24 + is_small_molecule_inhibitor_of CTX-M-27 + is_small_molecule_inhibitor_of CTX-M-55 + is_small_molecule_inhibitor_of CTX-M-65 + is_small_molecule_inhibitor_of CMY-8 + is_small_molecule_inhibitor_of MOX-1 + is_small_molecule_inhibitor_of IMP-4 + is_small_molecule_inhibitor_of KPC-2 + is_small_molecule_inhibitor_of KPC-3 + diazabicyclooctane + is_small_molecule_inhibitor_of MAB |
| Sub-Term(s) | 3 ontology terms | Show + ceftazidime-avibactam [Antibiotic+Adjuvant] has_part + aztreonam-avibactam [Antibiotic+Adjuvant] has_part + ceftaroline-avibactam [Antibiotic+Adjuvant] has_part |
| Publications | Stachyra T, et al. 2010. Antimicrob Agents Chemother 54(12): 5132-5138. Mechanistic studies of the inactivation of TEM-1 and P99 by NXL104, a novel non-beta-lactam beta-lactamase inhibitor. (PMID 20921316) Hidalgo JA, et al. 2016. Drug Des Devel Ther 10:2379-86 Ceftazidime/avibactam: a novel cephalosporin/nonbeta-lactam beta-lactamase inhibitor for the treatment of complicated urinary tract infections and complicated intra-abdominal infections. (PMID 27528799) Torrens G, et al. 2016. Antimicrob. Agents Chemother. : Activity of ceftazidime-avibactam against clinical and isogenic laboratory Pseudomonas aeruginosa isolates expressing combinations of most relevant β-lactam resistance mechanisms. (PMID 27480848) |
| Curator | Description | Most Recent Edit |
|---|