avibactam [Adjuvant]

Download Sequences


Ontology CARD's Antibiotic Resistance Ontology
Accession ARO:3000588
Synonym(s)NXL-104
DefinitionSerine beta-lactamase inhibitor targeting class A, class C, and some class D enzymes.
SMILESNC(=O)[C@@H]1CC[C@@H]2CN1C(=O)N2OS(=O)(=O)O
PubChem24944097
ChEBI85984
CAS1192500-31-4
ChEMBLCHEMBL1689063
Classification5 ontology terms | Show
Parent Term(s)29 ontology terms | Show
+ is_small_molecule_inhibitor_of TEM-1
+ is_small_molecule_inhibitor_of TEM-3
+ is_small_molecule_inhibitor_of TEM-9
+ is_small_molecule_inhibitor_of TEM-10
+ is_small_molecule_inhibitor_of TEM-12
+ is_small_molecule_inhibitor_of TEM-26
+ is_small_molecule_inhibitor_of TEM-28
+ is_small_molecule_inhibitor_of TEM-71
+ is_small_molecule_inhibitor_of SHV-1
+ is_small_molecule_inhibitor_of SHV-2
+ is_small_molecule_inhibitor_of SHV-3
+ is_small_molecule_inhibitor_of SHV-4
+ is_small_molecule_inhibitor_of SHV-7
+ is_small_molecule_inhibitor_of SHV-18
+ is_small_molecule_inhibitor_of SHV-52
+ is_small_molecule_inhibitor_of OXA-1
+ is_small_molecule_inhibitor_of ACT-1
+ is_small_molecule_inhibitor_of CTX-M-15
+ is_small_molecule_inhibitor_of CTX-M-24
+ is_small_molecule_inhibitor_of CTX-M-27
+ is_small_molecule_inhibitor_of CTX-M-55
+ is_small_molecule_inhibitor_of CTX-M-65
+ is_small_molecule_inhibitor_of CMY-8
+ is_small_molecule_inhibitor_of MOX-1
+ is_small_molecule_inhibitor_of IMP-4
+ is_small_molecule_inhibitor_of KPC-2
+ is_small_molecule_inhibitor_of KPC-3
+ diazabicyclooctane
+ is_small_molecule_inhibitor_of MAB
Sub-Term(s)
3 ontology terms | Show
+ ceftazidime-avibactam [Antibiotic+Adjuvant] has_part
+ aztreonam-avibactam [Antibiotic+Adjuvant] has_part
+ ceftaroline-avibactam [Antibiotic+Adjuvant] has_part
Publications

Stachyra T, et al. 2010. Antimicrob Agents Chemother 54(12): 5132-5138. Mechanistic studies of the inactivation of TEM-1 and P99 by NXL104, a novel non-beta-lactam beta-lactamase inhibitor. (PMID 20921316)

Hidalgo JA, et al. 2016. Drug Des Devel Ther 10:2379-86 Ceftazidime/avibactam: a novel cephalosporin/nonbeta-lactam beta-lactamase inhibitor for the treatment of complicated urinary tract infections and complicated intra-abdominal infections. (PMID 27528799)

Torrens G, et al. 2016. Antimicrob. Agents Chemother. : Activity of ceftazidime-avibactam against clinical and isogenic laboratory Pseudomonas aeruginosa isolates expressing combinations of most relevant β-lactam resistance mechanisms. (PMID 27480848)

Curator Acknowledgements
Curator Description Most Recent Edit