| Ontology | CARD's Antibiotic Resistance Ontology |
| Accession | ARO:3000528 |
| Synonym(s) | Aureomycin Eremomycine |
| Definition | Chlortetracycline was an early, first-generation tetracycline antibiotic developed in the 1940's. It inhibits bacterial protein synthesis by binding to the 30S subunit of bacterial ribosomes, preventing the aminoacyl-tRNA from binding to the ribosome. |
| SMILES | CN(C)[C@@H]1C(O)=C(C(N)=O)C(=O)[C@@]2(O)C(O)=C3C(=O)c4c(O)ccc(Cl)c4[C@@](C)(O)[C@H]3C[C@@H]12 |
| PubChem | 54675777 |
| ChEMBL | CHEMBL404520 |
| ChEBI | 27644 |
| CAS | 57-62-5 |
| Drug Class | tetracycline antibiotic |
| Classification | 2 ontology terms | Show |
| Parent Term(s) | 1 ontology terms | Show + tetracycline antibiotic [Drug Class] |
| Sub-Term(s) | 16 ontology terms | Show + antibiotic sensitive 16S rRNA targeted_by_antibiotic + tet(X) confers_resistance_to_antibiotic + tet(32) confers_resistance_to_antibiotic + tet(36) confers_resistance_to_antibiotic + tetB(P) confers_resistance_to_antibiotic + tet(Q) confers_resistance_to_antibiotic + tet(S) confers_resistance_to_antibiotic + tet(T) confers_resistance_to_antibiotic + tet(W) confers_resistance_to_antibiotic + tet(M) confers_resistance_to_antibiotic + tet(O) confers_resistance_to_antibiotic + tet(44) confers_resistance_to_antibiotic + Escherichia coli LamB confers_resistance_to_antibiotic + tet(W/N/W) confers_resistance_to_antibiotic + tet(59) confers_resistance_to_antibiotic + lmrP confers_resistance_to_antibiotic |
| Publications | Chopra I and Roberts M. 2001. Microbiol Mol Biol Rev 65(2): 232-260. Tetracycline antibiotics: mode of action, applications, molecular biology, and epidemiology of bacterial resistance. (PMID 11381101) Thaker M, et al. 2010. Cell Mol Life Sci 67(3): 419-431. The tetracycline resistome. (PMID 19862477) |
| Curator | Description | Most Recent Edit |
|---|