| Ontology | CARD's Antibiotic Resistance Ontology |
| Accession | ARO:3007031 |
| Definition | A serine beta-lactamase inhibitor that prevents the degradation of imipenem in the body. |
| SMILES | O.O=C(NC1CCNCC1)[C@@H]1CC[C@@H]2CN1C(=O)N2OS(=O)(=O)O |
| PubChem | 44129647 |
| ChEMBL | CHEMBL3301605 |
| AMR Gene Family | PDC beta-lactamase, KPC beta-lactamase |
| Drug Class | penicillin beta-lactam, cephalosporin, carbapenem, monobactam |
| Resistance Mechanism | antibiotic inactivation |
| Classification | 33 ontology terms | Show + process or component of antibiotic biology or chemistry + mechanism of antibiotic resistance + determinant of antibiotic resistance + antibiotic molecule + antibiotic inactivation [Resistance Mechanism] + antibiotic inactivation enzyme + hydrolysis of antibiotic conferring resistance + beta-lactam antibiotic + resistance-modifying agents + inhibitor of antibiotic resistance mechanism + hydrolysis of beta-lactam antibiotic by serine beta-lactamase + penicillin beta-lactam [Drug Class] + beta-lactamase + cephalosporin [Drug Class] + penicillin with extended spectrum + third-generation cephalosporin [Drug Subclass] + second-generation cephalosporin [Drug Subclass] + first-generation cephalosporin [Drug Subclass] + class A beta-lactamase + class C beta-lactamase + beta-lactamase inhibitor + carbapenem [Drug Class] + monobactam [Drug Class] + serine beta-lactamase inhibitor + cefalotin [Antibiotic] + cefixime [Antibiotic] + ampicillin [Antibiotic] + PDC beta-lactamase [AMR Gene Family] + KPC beta-lactamase [AMR Gene Family] + ceftriaxone [Antibiotic] + ceftazidime [Antibiotic] + cefazolin [Antibiotic] + cefoxitin [Antibiotic] |
| Parent Term(s) | 5 ontology terms | Show + is_small_molecule_inhibitor_of KPC-2 + is_small_molecule_inhibitor_of KPC-3 + is_small_molecule_inhibitor_of KPC-4 + is_small_molecule_inhibitor_of PDC-3 + diazabicyclooctane |
| Sub-Term(s) | 1 ontology terms | Show + imipenem-cilastatin-relebactam [Antibiotic+Adjuvant] has_part |
| Publications | Mangion IK, et al. 2011. Org Lett 13(20):5480-3 A concise synthesis of a β-lactamase inhibitor. (PMID 21916523) Hirsch EB, et al. 2012. Antimicrob Agents Chemother 56(7):3753-7 In vitro activity of MK-7655, a novel β-lactamase inhibitor, in combination with imipenem against carbapenem-resistant Gram-negative bacteria. (PMID 22526311) |
| Curator | Description | Most Recent Edit |
|---|