minocycline [Antibiotic]

Download Sequences


Ontology CARD's Antibiotic Resistance Ontology
Accession ARO:3000152
DefinitionMinocycline is second generation semi-synthetic derivative of the tetracycline group of antibiotics. It inhibits bacterial protein synthesis by binding to the 30S subunit of the bacterial ribosome and preventing the aminotransferase-tRNA from associating with the ribosome.
SMILESCN(C)c1ccc(O)c2c1C[C@H]1C[C@H]3[C@H](N(C)C)C(O)=C(C(N)=O)C(=O)[C@@]3(O)C(O)=C1C2=O
PubChem54675783
ChEMBLCHEMBL1434
ChEBI50694
CAS10118-90-8
Drug Classtetracycline antibiotic
Classification2 ontology terms | Show
Parent Term(s)1 ontology terms | Show
Sub-Term(s)
20 ontology terms | Show
+ antibiotic sensitive 16S rRNA targeted_by_antibiotic
+ tet(X) confers_resistance_to_antibiotic
+ tet(32) confers_resistance_to_antibiotic
+ tet(36) confers_resistance_to_antibiotic
+ tetB(P) confers_resistance_to_antibiotic
+ tet(Q) confers_resistance_to_antibiotic
+ tet(S) confers_resistance_to_antibiotic
+ tet(T) confers_resistance_to_antibiotic
+ tet(W) confers_resistance_to_antibiotic
+ tet(M) confers_resistance_to_antibiotic
+ tet(O) confers_resistance_to_antibiotic
+ tet(44) confers_resistance_to_antibiotic
+ tet(W/N/W) confers_resistance_to_antibiotic
+ tet(53) confers_resistance_to_antibiotic
+ tet(55) confers_resistance_to_antibiotic
+ tet(61) confers_resistance_to_antibiotic
+ tet(X1) confers_resistance_to_antibiotic
+ tet(X5) confers_resistance_to_antibiotic
+ tet(X6) confers_resistance_to_antibiotic
+ lmrP confers_resistance_to_antibiotic
Publications

Chopra I and Roberts M. 2001. Microbiol Mol Biol Rev 65(2): 232-260. Tetracycline antibiotics: mode of action, applications, molecular biology, and epidemiology of bacterial resistance. (PMID 11381101)

Thaker M, et al. 2010. Cell Mol Life Sci 67(3): 419-431. The tetracycline resistome. (PMID 19862477)

Curator Acknowledgements
Curator Description Most Recent Edit