Ontology | CARD's Antibiotic Resistance Ontology |
Accession | ARO:3000152 |
Definition | Minocycline is second generation semi-synthetic derivative of the tetracycline group of antibiotics. It inhibits bacterial protein synthesis by binding to the 30S subunit of the bacterial ribosome and preventing the aminotransferase-tRNA from associating with the ribosome. |
SMILES | CN(C)c1ccc(O)c2c1C[C@H]1C[C@H]3[C@H](N(C)C)C(O)=C(C(N)=O)C(=O)[C@@]3(O)C(O)=C1C2=O |
PubChem | 54675783 |
ChEMBL | CHEMBL1434 |
ChEBI | 50694 |
CAS | 10118-90-8 |
Drug Class | tetracycline antibiotic |
Classification | 2 ontology terms | Show |
Parent Term(s) | 1 ontology terms | Show + tetracycline antibiotic [Drug Class] |
Sub-Term(s) | 20 ontology terms | Show + antibiotic sensitive 16S rRNA targeted_by_antibiotic + tet(X) confers_resistance_to_antibiotic + tet(32) confers_resistance_to_antibiotic + tet(36) confers_resistance_to_antibiotic + tetB(P) confers_resistance_to_antibiotic + tet(Q) confers_resistance_to_antibiotic + tet(S) confers_resistance_to_antibiotic + tet(T) confers_resistance_to_antibiotic + tet(W) confers_resistance_to_antibiotic + tet(M) confers_resistance_to_antibiotic + tet(O) confers_resistance_to_antibiotic + tet(44) confers_resistance_to_antibiotic + tet(W/N/W) confers_resistance_to_antibiotic + tet(53) confers_resistance_to_antibiotic + tet(55) confers_resistance_to_antibiotic + tet(61) confers_resistance_to_antibiotic + tet(X1) confers_resistance_to_antibiotic + tet(X5) confers_resistance_to_antibiotic + tet(X6) confers_resistance_to_antibiotic + lmrP confers_resistance_to_antibiotic |
Publications | Chopra I and Roberts M. 2001. Microbiol Mol Biol Rev 65(2): 232-260. Tetracycline antibiotics: mode of action, applications, molecular biology, and epidemiology of bacterial resistance. (PMID 11381101) Thaker M, et al. 2010. Cell Mol Life Sci 67(3): 419-431. The tetracycline resistome. (PMID 19862477) |
Curator | Description | Most Recent Edit |
---|