| Ontology | CARD's Antibiotic Resistance Ontology |
| Accession | ARO:3007299 |
| Synonym(s) | VNRX-7145 |
| Definition | Ledaborbactam Etzadroxil is an orally bioavailable prodrug of ledaborbactam. |
| SMILES | CCC(=O)N[C@H]1Cc2cccc(C(=O)OCOC(=O)C(CC)CC)c2OB1O |
| PubChem | 138455030 |
| ChEMBL | CHEMBL4594425 |
| AMR Gene Family | KPC beta-lactamase, CTX-M beta-lactamase, SHV beta-lactamase |
| Drug Class | azole antibiotic, penicillin beta-lactam, cephalosporin, imidazole antibiotic, carbapenem, monobactam |
| Resistance Mechanism | antibiotic inactivation |
| Classification | 33 ontology terms | Show + process or component of antibiotic biology or chemistry + mechanism of antibiotic resistance + determinant of antibiotic resistance + antibiotic inactivation [Resistance Mechanism] + antibiotic inactivation enzyme + hydrolysis of antibiotic conferring resistance + antibiotic molecule + hydrolysis of beta-lactam antibiotic by serine beta-lactamase + beta-lactam antibiotic + beta-lactamase + resistance-modifying agents + azole antibiotic [Drug Class] + inhibitor of antibiotic resistance mechanism + class A beta-lactamase + penicillin beta-lactam [Drug Class] + cephalosporin [Drug Class] + penicillin with extended spectrum + third-generation cephalosporin [Drug Subclass] + first-generation cephalosporin [Drug Subclass] + imidazole antibiotic [Drug Class] + SHV-LEN beta-lactamase + beta-lactamase inhibitor + carbapenem [Drug Class] + monobactam [Drug Class] + serine beta-lactamase inhibitor + cefalotin [Antibiotic] + ampicillin [Antibiotic] + KPC beta-lactamase [AMR Gene Family] + CTX-M beta-lactamase [AMR Gene Family] + SHV beta-lactamase [AMR Gene Family] + ceftriaxone [Antibiotic] + ceftazidime [Antibiotic] + cefazolin [Antibiotic] |
| Parent Term(s) | 4 ontology terms | Show + is_small_molecule_inhibitor_of SHV-5 + is_small_molecule_inhibitor_of CTX-M-15 + is_small_molecule_inhibitor_of KPC-2 + boronic acid beta-lactamase inhibitor |
| Publications | Trout RE, et al. 2021. J Med Chem 64(14):10155-10166 Discovery of VNRX-7145 (VNRX-5236 Etzadroxil): An Orally Bioavailable β-Lactamase Inhibitor for Enterobacterales Expressing Ambler Class A, C, and D Enzymes. (PMID 34191513) |
| Curator | Description | Most Recent Edit |
|---|