| Ontology | CARD's Antibiotic Resistance Ontology |
| Accession | ARO:3007297 |
| Definition | ARX1796 is an orally bioavailable prodrug of avibactam. |
| SMILES | CCOC(=O)C(C)(C)COS(=O)(=O)ON1C(=O)N2C[C@H]1CC[C@H]2C(N)=O |
| PubChem | 135339165 |
| ChEMBL | CHEMBL4284604 |
| AMR Gene Family | OXA-1-like beta-lactamase, class A Mycobacterium abscessus beta-lactamase, MOX beta-lactamase, ACT beta-lactamase, CMY beta-lactamase, KPC beta-lactamase, IMP beta-lactamase, CTX-M beta-lactamase, SHV beta-lactamase, TEM beta-lactamase |
| Drug Class | penicillin beta-lactam, azole antibiotic, cephalosporin, imidazole antibiotic, carbapenem, monobactam |
| Resistance Mechanism | antibiotic inactivation |
| Classification | 58 ontology terms | Show + process or component of antibiotic biology or chemistry + mechanism of antibiotic resistance + determinant of antibiotic resistance + antibiotic molecule + antibiotic inactivation [Resistance Mechanism] + antibiotic inactivation enzyme + hydrolysis of antibiotic conferring resistance + beta-lactam antibiotic + hydrolysis of beta-lactam antibiotic by serine beta-lactamase + penicillin beta-lactam [Drug Class] + beta-lactamase + beta-lactamase resistant penicillin + hydrolysis of beta-lactam antibiotic by metallo-beta-lactamase + class C beta-lactamase + resistance-modifying agents + penicillin with extended spectrum + azole antibiotic [Drug Class] + inhibitor of antibiotic resistance mechanism + CMY-LAT-MOX beta-lactamase + class A beta-lactamase + class D beta-lactamase + class B (metallo-) beta-lactamase + oxacillin [Antibiotic] + cephalosporin [Drug Class] + third-generation cephalosporin [Drug Subclass] + second-generation cephalosporin [Drug Subclass] + first-generation cephalosporin [Drug Subclass] + imidazole antibiotic [Drug Class] + ampicillin [Antibiotic] + subclass B1 (metallo-) beta-lactamase + SHV-LEN beta-lactamase + CMY-MOX beta-lactamase + CMY-LAT beta-lactamase + beta-lactamase inhibitor + OXA beta-lactamase + carbapenem [Drug Class] + monobactam [Drug Class] + OXA-1-like beta-lactamase [AMR Gene Family] + class A Mycobacterium abscessus beta-lactamase [AMR Gene Family] + serine beta-lactamase inhibitor + ticarcillin [Antibiotic] + cefalotin [Antibiotic] + cefixime [Antibiotic] + MOX beta-lactamase [AMR Gene Family] + ACT beta-lactamase [AMR Gene Family] + CMY beta-lactamase [AMR Gene Family] + KPC beta-lactamase [AMR Gene Family] + IMP beta-lactamase [AMR Gene Family] + CTX-M beta-lactamase [AMR Gene Family] + SHV beta-lactamase [AMR Gene Family] + TEM beta-lactamase [AMR Gene Family] + piperacillin [Antibiotic] + ertapenem [Antibiotic] + amoxicillin [Antibiotic] + cefuroxime [Antibiotic] + ceftriaxone [Antibiotic] + ceftazidime [Antibiotic] + cefazolin [Antibiotic] |
| Parent Term(s) | 29 ontology terms | Show + is_small_molecule_inhibitor_of TEM-1 + is_small_molecule_inhibitor_of TEM-3 + is_small_molecule_inhibitor_of TEM-9 + is_small_molecule_inhibitor_of TEM-10 + is_small_molecule_inhibitor_of TEM-12 + is_small_molecule_inhibitor_of TEM-26 + is_small_molecule_inhibitor_of TEM-28 + is_small_molecule_inhibitor_of TEM-71 + is_small_molecule_inhibitor_of SHV-1 + is_small_molecule_inhibitor_of SHV-2 + is_small_molecule_inhibitor_of SHV-3 + is_small_molecule_inhibitor_of SHV-4 + is_small_molecule_inhibitor_of SHV-7 + is_small_molecule_inhibitor_of SHV-18 + is_small_molecule_inhibitor_of SHV-52 + is_small_molecule_inhibitor_of OXA-1 + is_small_molecule_inhibitor_of ACT-1 + is_small_molecule_inhibitor_of CTX-M-15 + is_small_molecule_inhibitor_of CTX-M-24 + is_small_molecule_inhibitor_of CTX-M-27 + is_small_molecule_inhibitor_of CTX-M-55 + is_small_molecule_inhibitor_of CTX-M-65 + is_small_molecule_inhibitor_of CMY-8 + is_small_molecule_inhibitor_of MOX-1 + is_small_molecule_inhibitor_of IMP-4 + is_small_molecule_inhibitor_of KPC-2 + is_small_molecule_inhibitor_of KPC-3 + diazabicyclooctane + is_small_molecule_inhibitor_of MAB |
| Publications | Veeraraghavan B, et al. 2021. Infect Dis Ther 10(4):1815-1835 Oral Antibiotics in Clinical Development for Community-Acquired Urinary Tract Infections. (PMID 34357517) |
| Curator | Description | Most Recent Edit |
|---|