ARX1796 [Adjuvant]

Download Sequences


Ontology CARD's Antibiotic Resistance Ontology
Accession ARO:3007297
DefinitionARX1796 is an orally bioavailable prodrug of avibactam.
SMILESCCOC(=O)C(C)(C)COS(=O)(=O)ON1C(=O)N2C[C@H]1CC[C@H]2C(N)=O
PubChem135339165
ChEMBLCHEMBL4284604
AMR Gene FamilyOXA-1-like beta-lactamase, class A Mycobacterium abscessus beta-lactamase, MOX beta-lactamase, ACT beta-lactamase, CMY beta-lactamase, KPC beta-lactamase, IMP beta-lactamase, CTX-M beta-lactamase, SHV beta-lactamase, TEM beta-lactamase
Drug Classpenicillin beta-lactam, azole antibiotic, cephalosporin, imidazole antibiotic, carbapenem, monobactam
Resistance Mechanismantibiotic inactivation
Classification58 ontology terms | Show
+ process or component of antibiotic biology or chemistry
+ mechanism of antibiotic resistance
+ determinant of antibiotic resistance
+ antibiotic molecule
+ antibiotic inactivation [Resistance Mechanism]
+ antibiotic inactivation enzyme
+ hydrolysis of antibiotic conferring resistance
+ beta-lactam antibiotic
+ hydrolysis of beta-lactam antibiotic by serine beta-lactamase
+ penicillin beta-lactam [Drug Class]
+ beta-lactamase
+ beta-lactamase resistant penicillin
+ hydrolysis of beta-lactam antibiotic by metallo-beta-lactamase
+ class C beta-lactamase
+ resistance-modifying agents
+ penicillin with extended spectrum
+ azole antibiotic [Drug Class]
+ inhibitor of antibiotic resistance mechanism
+ CMY-LAT-MOX beta-lactamase
+ class A beta-lactamase
+ class D beta-lactamase
+ class B (metallo-) beta-lactamase
+ oxacillin [Antibiotic]
+ cephalosporin [Drug Class]
+ third-generation cephalosporin [Drug Subclass]
+ second-generation cephalosporin [Drug Subclass]
+ first-generation cephalosporin [Drug Subclass]
+ imidazole antibiotic [Drug Class]
+ ampicillin [Antibiotic]
+ subclass B1 (metallo-) beta-lactamase
+ SHV-LEN beta-lactamase
+ CMY-MOX beta-lactamase
+ CMY-LAT beta-lactamase
+ beta-lactamase inhibitor
+ OXA beta-lactamase
+ carbapenem [Drug Class]
+ monobactam [Drug Class]
+ OXA-1-like beta-lactamase [AMR Gene Family]
+ class A Mycobacterium abscessus beta-lactamase [AMR Gene Family]
+ serine beta-lactamase inhibitor
+ ticarcillin [Antibiotic]
+ cefalotin [Antibiotic]
+ cefixime [Antibiotic]
+ MOX beta-lactamase [AMR Gene Family]
+ ACT beta-lactamase [AMR Gene Family]
+ CMY beta-lactamase [AMR Gene Family]
+ KPC beta-lactamase [AMR Gene Family]
+ IMP beta-lactamase [AMR Gene Family]
+ CTX-M beta-lactamase [AMR Gene Family]
+ SHV beta-lactamase [AMR Gene Family]
+ TEM beta-lactamase [AMR Gene Family]
+ piperacillin [Antibiotic]
+ ertapenem [Antibiotic]
+ amoxicillin [Antibiotic]
+ cefuroxime [Antibiotic]
+ ceftriaxone [Antibiotic]
+ ceftazidime [Antibiotic]
+ cefazolin [Antibiotic]
Parent Term(s)29 ontology terms | Show
+ is_small_molecule_inhibitor_of TEM-1
+ is_small_molecule_inhibitor_of TEM-3
+ is_small_molecule_inhibitor_of TEM-9
+ is_small_molecule_inhibitor_of TEM-10
+ is_small_molecule_inhibitor_of TEM-12
+ is_small_molecule_inhibitor_of TEM-26
+ is_small_molecule_inhibitor_of TEM-28
+ is_small_molecule_inhibitor_of TEM-71
+ is_small_molecule_inhibitor_of SHV-1
+ is_small_molecule_inhibitor_of SHV-2
+ is_small_molecule_inhibitor_of SHV-3
+ is_small_molecule_inhibitor_of SHV-4
+ is_small_molecule_inhibitor_of SHV-7
+ is_small_molecule_inhibitor_of SHV-18
+ is_small_molecule_inhibitor_of SHV-52
+ is_small_molecule_inhibitor_of OXA-1
+ is_small_molecule_inhibitor_of ACT-1
+ is_small_molecule_inhibitor_of CTX-M-15
+ is_small_molecule_inhibitor_of CTX-M-24
+ is_small_molecule_inhibitor_of CTX-M-27
+ is_small_molecule_inhibitor_of CTX-M-55
+ is_small_molecule_inhibitor_of CTX-M-65
+ is_small_molecule_inhibitor_of CMY-8
+ is_small_molecule_inhibitor_of MOX-1
+ is_small_molecule_inhibitor_of IMP-4
+ is_small_molecule_inhibitor_of KPC-2
+ is_small_molecule_inhibitor_of KPC-3
+ diazabicyclooctane
+ is_small_molecule_inhibitor_of MAB
Publications

Veeraraghavan B, et al. 2021. Infect Dis Ther 10(4):1815-1835 Oral Antibiotics in Clinical Development for Community-Acquired Urinary Tract Infections. (PMID 34357517)

Curator Acknowledgements
Curator Description Most Recent Edit